C22H32BFN2O4 — CID 72678883
tert-butyl 2-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 72678883) has the molecular formula C22H32BFN2O4 and a molecular weight of 418.32 g/mol. Its IUPAC name is tert-butyl 2-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl 2-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 72678883 |
| Molecular Formula | C22H32BFN2O4 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | tert-butyl 2-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(c1cnc(F)c(B3OC(C)(C)C(C)(C)O3)c1)C2 |
| InChI | InChI=1S/C22H32BFN2O4/c1-20(2,3)28-19(27)26-14-8-9-17(26)15(11-14)13-10-16(18(24)25-12-13)23-29-21(4,5)22(6,7)30-23/h10,12,14-15,17H,8-9,11H2,1-7H3 |
| InChIKey | LHRKHSMVMVRNPY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|