C20H19NO2 — CID 72684073
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenyl-2,3-dihydroinden-1-ol (PubChem CID 72684073) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenyl-2,3-dihydroinden-1-ol.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenyl-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 72684073 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenyl-2,3-dihydroinden-1-ol |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)C(O)(c1ccccc1)CC2 |
| InChI | InChI=1S/C20H19NO2/c1-13-19(14(2)23-21-13)16-9-8-15-10-11-20(22,18(15)12-16)17-6-4-3-5-7-17/h3-9,12,22H,10-11H2,1-2H3 |
| InChIKey | SEOJJNHYXOQNOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |