C20H26N2O3S — CID 72685920
3-(2-methylpent-2-enoyl)-N-[3-(2-methylprop-2-enoxy)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 72685920) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 3-(2-methylpent-2-enoyl)-N-[3-(2-methylprop-2-enoxy)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(2-methylpent-2-enoyl)-N-[3-(2-methylprop-2-enoxy)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 72685920 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-(2-methylpent-2-enoyl)-N-[3-(2-methylprop-2-enoxy)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | C=C(C)COc1cccc(NC(=O)C2CSCN2C(=O)C(C)=CCC)c1 |
| InChI | InChI=1S/C20H26N2O3S/c1-5-7-15(4)20(24)22-13-26-12-18(22)19(23)21-16-8-6-9-17(10-16)25-11-14(2)3/h6-10,18H,2,5,11-13H2,1,3-4H3,(H,21,23) |
| InChIKey | WUGBJKGYYBGWAF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|