C15H15N3O3S — CID 7268826
(2S)-N-[3-(1,3-thiazol-2-ylcarbamoyl)phenyl]oxolane-2-carboxamide (PubChem CID 7268826) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2S)-N-[3-(1,3-thiazol-2-ylcarbamoyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-(1,3-thiazol-2-ylcarbamoyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 7268826 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2S)-N-[3-(1,3-thiazol-2-ylcarbamoyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccc(NC(=O)[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C15H15N3O3S/c19-13(18-15-16-6-8-22-15)10-3-1-4-11(9-10)17-14(20)12-5-2-7-21-12/h1,3-4,6,8-9,12H,2,5,7H2,(H,17,20)(H,16,18,19)/t12-/m0/s1 |
| InChIKey | DZHRDBNQEYOOEJ-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |