C21H21ClN4OS2 — CID 72688401
3-[5-(3-chlorophenyl)thiophen-2-yl]-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 72688401) has the molecular formula C21H21ClN4OS2 and a molecular weight of 445.01 g/mol. Its IUPAC name is 3-[5-(3-chlorophenyl)thiophen-2-yl]-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[5-(3-chlorophenyl)thiophen-2-yl]-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72688401 |
| Molecular Formula | C21H21ClN4OS2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-[5-(3-chlorophenyl)thiophen-2-yl]-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cn1c(C2CCN(C(=O)C=Cc3ccc(-c4cccc(Cl)c4)s3)CC2)n[nH]c1=S |
| InChI | InChI=1S/C21H21ClN4OS2/c1-25-20(23-24-21(25)28)14-9-11-26(12-10-14)19(27)8-6-17-5-7-18(29-17)15-3-2-4-16(22)13-15/h2-8,13-14H,9-12H2,1H3,(H,24,28) |
| InChIKey | OMVDHVZAQAQIPK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|