C18H25N3O — CID 72689962
N-(1-tert-butylbenzimidazol-2-yl)-4,4-dimethylpent-2-enamide (PubChem CID 72689962) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(1-tert-butylbenzimidazol-2-yl)-4,4-dimethylpent-2-enamide.
| Compound Name | N-(1-tert-butylbenzimidazol-2-yl)-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 72689962 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(1-tert-butylbenzimidazol-2-yl)-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)C=CC(=O)Nc1nc2ccccc2n1C(C)(C)C |
| InChI | InChI=1S/C18H25N3O/c1-17(2,3)12-11-15(22)20-16-19-13-9-7-8-10-14(13)21(16)18(4,5)6/h7-12H,1-6H3,(H,19,20,22) |
| InChIKey | DXZVXLTYGAMULD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|