About tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate
tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate (PubChem CID 72690787) has the molecular formula C21H27N3O4
and a molecular weight of 385.46 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate |
| PubChem CID | 72690787 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(NC(=O)C=Cc1nc2ccccc2o1)C1CC1 |
| InChI | InChI=1S/C21H27N3O4/c1-20(2,3)28-19(26)22-13-21(4,14-9-10-14)24-17(25)11-12-18-23-15-7-5-6-8-16(15)27-18/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,22,26)(H,24,25) |
| InChIKey | CXXFZIGBBZFOPY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate?
The IUPAC name of tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate (CID 72690787) is tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate is CC(C)(C)OC(=O)NCC(C)(NC(=O)C=Cc1nc2ccccc2o1)C1CC1.
What is the InChIKey of tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate?
The InChIKey is CXXFZIGBBZFOPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O4/c1-20(2,3)28-19(26)22-13-21(4,14-9-10-14)24-17(25)11-12-18-23-15-7-5-6-8-16(15)27-18/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,22,26)(H,24,25).
What are the key properties of tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate?
tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate has a molecular weight of 385.46 g/mol, XLogP of 3.65, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-cyclopropylpropyl]carbamate is sourced from PubChem (CID 72690787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).