C24H26N4O3 — CID 72691908
2-[[amino-(2-phenoxy-3-pyridinyl)methylidene]amino]oxy-N-(2-propan-2-ylphenyl)propanamide (PubChem CID 72691908) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[[amino-(2-phenoxy-3-pyridinyl)methylidene]amino]oxy-N-(2-propan-2-ylphenyl)propanamide.
| Compound Name | 2-[[amino-(2-phenoxy-3-pyridinyl)methylidene]amino]oxy-N-(2-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 72691908 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[[amino-(2-phenoxy-3-pyridinyl)methylidene]amino]oxy-N-(2-propan-2-ylphenyl)propanamide |
| SMILES | CC(ON=C(N)c1cccnc1Oc1ccccc1)C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C24H26N4O3/c1-16(2)19-12-7-8-14-21(19)27-23(29)17(3)31-28-22(25)20-13-9-15-26-24(20)30-18-10-5-4-6-11-18/h4-17H,1-3H3,(H2,25,28)(H,27,29) |
| InChIKey | BXEORKLLAVJDTK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|