About 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one
3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 72693716) has the molecular formula C17H10BrF3N2O
and a molecular weight of 395.18 g/mol. Its IUPAC name is 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| PubChem CID | 72693716 |
| Molecular Formula | C17H10BrF3N2O |
| Molecular Weight | 395.18 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cnc2ccc(Br)cn12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10BrF3N2O/c18-13-4-7-16-22-9-14(23(16)10-13)5-6-15(24)11-2-1-3-12(8-11)17(19,20)21/h1-10H |
| InChIKey | LZMFOAGSHUYNIE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one?
The IUPAC name of 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (CID 72693716) is 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
What is the SMILES notation for 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one?
The canonical SMILES for 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one is O=C(C=Cc1cnc2ccc(Br)cn12)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one?
The InChIKey is LZMFOAGSHUYNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10BrF3N2O/c18-13-4-7-16-22-9-14(23(16)10-13)5-6-15(24)11-2-1-3-12(8-11)17(19,20)21/h1-10H.
What are the key properties of 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one?
3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one has a molecular weight of 395.18 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one is sourced from PubChem (CID 72693716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).