About (2R,5R)-1,4-dioxane-2,5-diol
(2R,5R)-1,4-dioxane-2,5-diol (PubChem CID 7269377) has the molecular formula C4H8O4
and a molecular weight of 120.10 g/mol. Its IUPAC name is (2R,5R)-1,4-dioxane-2,5-diol.
Molecular Properties
| Compound Name | (2R,5R)-1,4-dioxane-2,5-diol |
| PubChem CID | 7269377 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | (2R,5R)-1,4-dioxane-2,5-diol |
| SMILES | O[C@H]1CO[C@@H](O)CO1 |
| InChI | InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | ATFVTAOSZBVGHC-QWWZWVQMSA-N |
| XLogP | -1.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,5R)-1,4-dioxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-1,4-dioxane-2,5-diol?
The IUPAC name of (2R,5R)-1,4-dioxane-2,5-diol (CID 7269377) is (2R,5R)-1,4-dioxane-2,5-diol.
What is the SMILES notation for (2R,5R)-1,4-dioxane-2,5-diol?
The canonical SMILES for (2R,5R)-1,4-dioxane-2,5-diol is O[C@H]1CO[C@@H](O)CO1.
What is the InChIKey of (2R,5R)-1,4-dioxane-2,5-diol?
The InChIKey is ATFVTAOSZBVGHC-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (2R,5R)-1,4-dioxane-2,5-diol?
(2R,5R)-1,4-dioxane-2,5-diol has a molecular weight of 120.10 g/mol, XLogP of -1.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-1,4-dioxane-2,5-diol is sourced from PubChem (CID 7269377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).