About CID 72694228
CID 72694228 (PubChem CID 72694228) has the molecular formula C23H31N3O2
and a molecular weight of 381.52 g/mol.
Molecular Properties
| Compound Name | CID 72694228 |
| PubChem CID | 72694228 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(OCCC3CC3)cc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C23H31N3O2/c1-15-21(24)26-23(25-15)20-13-19(28-12-9-16-3-4-16)6-5-17(20)14-22(23)10-7-18(27-2)8-11-22/h5-6,13,16,18H,3-4,7-12,14H2,1-2H3,(H2,24,26) |
| InChIKey | AGTQGRFUNIAYJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 72694228 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72694228?
The IUPAC name of CID 72694228 (CID 72694228) is not available.
What is the SMILES notation for CID 72694228?
The canonical SMILES for CID 72694228 is COC1CCC2(CC1)Cc1ccc(OCCC3CC3)cc1C21N=C(C)C(N)=N1.
What is the InChIKey of CID 72694228?
The InChIKey is AGTQGRFUNIAYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O2/c1-15-21(24)26-23(25-15)20-13-19(28-12-9-16-3-4-16)6-5-17(20)14-22(23)10-7-18(27-2)8-11-22/h5-6,13,16,18H,3-4,7-12,14H2,1-2H3,(H2,24,26).
What are the key properties of CID 72694228?
CID 72694228 has a molecular weight of 381.52 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72694228 is sourced from PubChem (CID 72694228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).