C10H11F6N5O2 — CID 72694295
2,2,2-trifluoro-N-[N'-(2-methoxyethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]acetamide (PubChem CID 72694295) has the molecular formula C10H11F6N5O2 and a molecular weight of 347.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[N'-(2-methoxyethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[N'-(2-methoxyethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 72694295 |
| Molecular Formula | C10H11F6N5O2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[N'-(2-methoxyethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]acetamide |
| SMILES | COCC/N=C(\NC(=O)C(F)(F)F)Nc1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C10H11F6N5O2/c1-23-3-2-17-8(19-7(22)10(14,15)16)18-6-4-5(20-21-6)9(11,12)13/h4H,2-3H2,1H3,(H3,17,18,19,20,21,22) |
| InChIKey | XRIJRDNNNSONPU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|