About 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one
2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one (PubChem CID 726944) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one.
Molecular Properties
| Compound Name | 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one |
| PubChem CID | 726944 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one |
| SMILES | O=c1c2ccccc2nc2n1CCO2 |
| InChI | InChI=1S/C10H8N2O2/c13-9-7-3-1-2-4-8(7)11-10-12(9)5-6-14-10/h1-4H,5-6H2 |
| InChIKey | QBEBJBXQJGORQQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one?
The IUPAC name of 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one (CID 726944) is 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one.
What is the SMILES notation for 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one?
The canonical SMILES for 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one is O=c1c2ccccc2nc2n1CCO2.
What is the InChIKey of 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one?
The InChIKey is QBEBJBXQJGORQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c13-9-7-3-1-2-4-8(7)11-10-12(9)5-6-14-10/h1-4H,5-6H2.
What are the key properties of 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one?
2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one has a molecular weight of 188.19 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-[1,3]oxazolo[2,3-b]quinazolin-5-one is sourced from PubChem (CID 726944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).