C15H24F3N5O2 — CID 72694492
N-[N'-(1-methoxypropan-2-yl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,3-dimethylbutanamide (PubChem CID 72694492) has the molecular formula C15H24F3N5O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is N-[N'-(1-methoxypropan-2-yl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,3-dimethylbutanamide.
| Compound Name | N-[N'-(1-methoxypropan-2-yl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 72694492 |
| Molecular Formula | C15H24F3N5O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[N'-(1-methoxypropan-2-yl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,3-dimethylbutanamide |
| SMILES | COCC(C)/N=C(\NC(=O)CC(C)(C)C)Nc1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C15H24F3N5O2/c1-9(8-25-5)19-13(21-12(24)7-14(2,3)4)20-11-6-10(22-23-11)15(16,17)18/h6,9H,7-8H2,1-5H3,(H3,19,20,21,22,23,24) |
| InChIKey | UDHOBSXCNZASQX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|