C33H37N5O5 — CID 72694494
(2R,5S,11S,14S,18E)-2,11-dimethyl-14-(2-phenylethyl)-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone (PubChem CID 72694494) has the molecular formula C33H37N5O5 and a molecular weight of 583.69 g/mol. Its IUPAC name is (2R,5S,11S,14S,18E)-2,11-dimethyl-14-(2-phenylethyl)-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone.
| Compound Name | (2R,5S,11S,14S,18E)-2,11-dimethyl-14-(2-phenylethyl)-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone |
|---|---|
| PubChem CID | 72694494 |
| Molecular Formula | C33H37N5O5 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | (2R,5S,11S,14S,18E)-2,11-dimethyl-14-(2-phenylethyl)-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone |
| SMILES | C[C@@H]1NC(=O)[C@H](CCc2ccccc2)NC(=O)C/C=C/c2cc3cc(ccc3cn2)[C@@H](C)OC(=O)[C@@H]2CCCN(N2)C1=O |
| InChI | InChI=1S/C33H37N5O5/c1-21-32(41)38-17-7-11-29(37-38)33(42)43-22(2)24-14-15-25-20-34-27(19-26(25)18-24)10-6-12-30(39)36-28(31(40)35-21)16-13-23-8-4-3-5-9-23/h3-6,8-10,14-15,18-22,28-29,37H,7,11-13,16-17H2,1-2H3,(H,35,40)(H,36,39)/b10-6+/t21-,22+,28-,29-/m0/s1 |
| InChIKey | XZKPXUNICKXJPS-HLFOJHDYSA-N |
| XLogP | 3.37 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |