C9H8F4N2O2S — CID 72694819
(1S)-2,2,5,7-tetrafluoro-1-(sulfamoylamino)-1,3-dihydroindene (PubChem CID 72694819) has the molecular formula C9H8F4N2O2S and a molecular weight of 284.23 g/mol. Its IUPAC name is (1S)-2,2,5,7-tetrafluoro-1-(sulfamoylamino)-1,3-dihydroindene.
| Compound Name | (1S)-2,2,5,7-tetrafluoro-1-(sulfamoylamino)-1,3-dihydroindene |
|---|---|
| PubChem CID | 72694819 |
| Molecular Formula | C9H8F4N2O2S |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (1S)-2,2,5,7-tetrafluoro-1-(sulfamoylamino)-1,3-dihydroindene |
| SMILES | NS(=O)(=O)N[C@H]1c2c(F)cc(F)cc2CC1(F)F |
| InChI | InChI=1S/C9H8F4N2O2S/c10-5-1-4-3-9(12,13)8(15-18(14,16)17)7(4)6(11)2-5/h1-2,8,15H,3H2,(H2,14,16,17)/t8-/m0/s1 |
| InChIKey | ZDUAYVUFBARRPR-QMMMGPOBSA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |