C26H29FN8O2 — CID 72694960
6-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-methoxyphenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 72694960) has the molecular formula C26H29FN8O2 and a molecular weight of 504.57 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-methoxyphenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-methoxyphenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 72694960 |
| Molecular Formula | C26H29FN8O2 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 6-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-methoxyphenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1cc(Nc2nc(-c3cnc4c(c3)NCCO4)cn3ccnc23)ccc1N1CCN(C)[C@@H](CF)C1 |
| InChI | InChI=1S/C26H29FN8O2/c1-33-8-9-34(15-19(33)13-27)22-4-3-18(12-23(22)36-2)31-24-25-29-5-7-35(25)16-21(32-24)17-11-20-26(30-14-17)37-10-6-28-20/h3-5,7,11-12,14,16,19,28H,6,8-10,13,15H2,1-2H3,(H,31,32)/t19-/m0/s1 |
| InChIKey | VWKVGRIOANZXPC-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|