About 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid
3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid (PubChem CID 72695132) has the molecular formula C26H23NO2
and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid |
| PubChem CID | 72695132 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid |
| SMILES | O=C(O)CCn1c(-c2ccccc2)c(-c2ccccc2)c2cc(C3CC3)ccc21 |
| InChI | InChI=1S/C26H23NO2/c28-24(29)15-16-27-23-14-13-21(18-11-12-18)17-22(23)25(19-7-3-1-4-8-19)26(27)20-9-5-2-6-10-20/h1-10,13-14,17-18H,11-12,15-16H2,(H,28,29) |
| InChIKey | VTCPSZSCIMRYND-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid?
The IUPAC name of 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid (CID 72695132) is 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid.
What is the SMILES notation for 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid?
The canonical SMILES for 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid is O=C(O)CCn1c(-c2ccccc2)c(-c2ccccc2)c2cc(C3CC3)ccc21.
What is the InChIKey of 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid?
The InChIKey is VTCPSZSCIMRYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO2/c28-24(29)15-16-27-23-14-13-21(18-11-12-18)17-22(23)25(19-7-3-1-4-8-19)26(27)20-9-5-2-6-10-20/h1-10,13-14,17-18H,11-12,15-16H2,(H,28,29).
What are the key properties of 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid?
3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid has a molecular weight of 381.48 g/mol, XLogP of 6.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclopropyl-2,3-diphenylindol-1-yl)propanoic acid is sourced from PubChem (CID 72695132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).