C26H24N6OS — CID 72695336
4-(1H-indazol-5-ylamino)-N-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 72695336) has the molecular formula C26H24N6OS and a molecular weight of 468.59 g/mol. Its IUPAC name is 4-(1H-indazol-5-ylamino)-N-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-(1H-indazol-5-ylamino)-N-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 72695336 |
| Molecular Formula | C26H24N6OS |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4-(1H-indazol-5-ylamino)-N-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCc2c(sc3ncnc(Nc4ccc5[nH]ncc5c4)c23)C1 |
| InChI | InChI=1S/C26H24N6OS/c33-25(27-11-10-16-4-2-1-3-5-16)17-6-8-20-22(13-17)34-26-23(20)24(28-15-29-26)31-19-7-9-21-18(12-19)14-30-32-21/h1-5,7,9,12,14-15,17H,6,8,10-11,13H2,(H,27,33)(H,30,32)(H,28,29,31) |
| InChIKey | XJYPXLQQUTWACI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |