C27H29N7O2 — CID 72695564
6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 72695564) has the molecular formula C27H29N7O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 72695564 |
| Molecular Formula | C27H29N7O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1cn2cc(-c3ccc4c(c3)NCCO4)nc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)c2n1 |
| InChI | InChI=1S/C27H29N7O2/c1-6-25-23(28-8-14-36-25)15-19(1)24-16-34-9-7-29-27(34)26(31-24)30-20-2-4-21(5-3-20)32-10-12-33(13-11-32)22-17-35-18-22/h1-7,9,15-16,22,28H,8,10-14,17-18H2,(H,30,31) |
| InChIKey | JMUYSSBOQHMVKX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|