C13H24O5Si — CID 72695867
(4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one (PubChem CID 72695867) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is (4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one.
| Compound Name | (4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 72695867 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(CO)C(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O5Si/c1-13(2,3)19(4,5)18-9-6-8(7-14)10(15)12(17)11(9)16/h6,9,11-12,14,16-17H,7H2,1-5H3/t9-,11-,12+/m0/s1 |
| InChIKey | NSQXHQMZMFHQDR-ZMLRMANQSA-N |
| XLogP | 0.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|