C10H9F3O3 — CID 72695869
(1S,2R,5S,6S,7R)-5-hydroxy-5-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 72695869) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-5-hydroxy-5-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5S,6S,7R)-5-hydroxy-5-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 72695869 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (1S,2R,5S,6S,7R)-5-hydroxy-5-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1O[C@](O)(C(F)(F)F)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H9F3O3/c11-10(12,13)9(15)7-5-2-1-4(3-5)6(7)8(14)16-9/h1-2,4-7,15H,3H2/t4-,5+,6-,7+,9+/m1/s1 |
| InChIKey | IDLPKTPRCLGOOF-ALXXOCQFSA-N |
| XLogP | 1.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|