C16H21NOS — CID 72696080
(2E,4E,6E)-N-(3-methylbutyl)-7-thiophen-2-ylhepta-2,4,6-trienamide (PubChem CID 72696080) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is (2E,4E,6E)-N-(3-methylbutyl)-7-thiophen-2-ylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E,6E)-N-(3-methylbutyl)-7-thiophen-2-ylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 72696080 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2E,4E,6E)-N-(3-methylbutyl)-7-thiophen-2-ylhepta-2,4,6-trienamide |
| SMILES | CC(C)CCNC(=O)/C=C/C=C/C=C/c1cccs1 |
| InChI | InChI=1S/C16H21NOS/c1-14(2)11-12-17-16(18)10-6-4-3-5-8-15-9-7-13-19-15/h3-10,13-14H,11-12H2,1-2H3,(H,17,18)/b4-3+,8-5+,10-6+ |
| InChIKey | CDHCPJUXYQLWFD-IZMYCKBJSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|