C19H34O4 — CID 7269626
(1R,2S,4aS,5R,5'S,6R,8aR)-1,5'-bis(hydroxymethyl)-1,4a,5',6-tetramethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol (PubChem CID 7269626) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1R,2S,4aS,5R,5'S,6R,8aR)-1,5'-bis(hydroxymethyl)-1,4a,5',6-tetramethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol.
| Compound Name | (1R,2S,4aS,5R,5'S,6R,8aR)-1,5'-bis(hydroxymethyl)-1,4a,5',6-tetramethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol |
|---|---|
| PubChem CID | 7269626 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (1R,2S,4aS,5R,5'S,6R,8aR)-1,5'-bis(hydroxymethyl)-1,4a,5',6-tetramethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@](C)(CO)[C@@H](O)CC[C@]2(C)[C@@]12CC[C@@](C)(CO)O2 |
| InChI | InChI=1S/C19H34O4/c1-13-5-6-14-17(3,12-21)15(22)7-8-18(14,4)19(13)10-9-16(2,11-20)23-19/h13-15,20-22H,5-12H2,1-4H3/t13-,14-,15+,16+,17+,18+,19-/m1/s1 |
| InChIKey | RUJVTNAFWZHAOM-QFEFJCPZSA-N |
| XLogP | 2.49 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |