C26H26Cl4O13 — CID 72696437
[(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5S,6R)-6-[(2,6-dichlorobenzoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,6-dichlorobenzoate (PubChem CID 72696437) has the molecular formula C26H26Cl4O13 and a molecular weight of 688.29 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5S,6R)-6-[(2,6-dichlorobenzoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,6-dichlorobenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5S,6R)-6-[(2,6-dichlorobenzoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 72696437 |
| Molecular Formula | C26H26Cl4O13 |
| Molecular Weight | 688.29 g/mol |
| Exact Mass | 686.01 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5S,6R)-6-[(2,6-dichlorobenzoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2,6-dichlorobenzoate |
| SMILES | O=C(OC[C@H]1O[C@H](O[C@H]2O[C@H](COC(=O)c3c(Cl)cccc3Cl)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H26Cl4O13/c27-9-3-1-4-10(28)15(9)23(37)39-7-13-17(31)19(33)21(35)25(41-13)43-26-22(36)20(34)18(32)14(42-26)8-40-24(38)16-11(29)5-2-6-12(16)30/h1-6,13-14,17-22,25-26,31-36H,7-8H2/t13-,14-,17-,18-,19+,20+,21-,22-,25-,26-/m1/s1 |
| InChIKey | AFINUAKJZUIEAF-XAYPTDCESA-N |
| XLogP | 0.95 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |