C28H41NO7 — CID 72696702
2-[(2S,6S)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-methylideneoxan-2-yl]acetic acid (PubChem CID 72696702) has the molecular formula C28H41NO7 and a molecular weight of 503.64 g/mol. Its IUPAC name is 2-[(2S,6S)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-methylideneoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,6S)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-methylideneoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 72696702 |
| Molecular Formula | C28H41NO7 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-[(2S,6S)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-methylideneoxan-2-yl]acetic acid |
| SMILES | C=C1C[C@@H](CC(=O)O)O[C@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)OC(C)=O)C[C@@H]2C)C1 |
| InChI | InChI=1S/C28H41NO7/c1-17(7-10-23-13-18(2)14-24(36-23)16-28(32)33)8-11-26-19(3)15-25(21(5)35-26)29-27(31)12-9-20(4)34-22(6)30/h7-10,12,19-21,23-26H,2,11,13-16H2,1,3-6H3,(H,29,31)(H,32,33)/b10-7+,12-9-,17-8+/t19-,20-,21+,23+,24-,25+,26-/m0/s1 |
| InChIKey | LJUNMKJIHDBQKE-UKFUWTCXSA-N |
| XLogP | 4.26 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|