C25H35NO2 — CID 72696762
(5R,8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-5,17-diol (PubChem CID 72696762) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-5,17-diol.
| Compound Name | (5R,8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-5,17-diol |
|---|---|
| PubChem CID | 72696762 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (5R,8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-5,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@]4(O)C=CCC[C@]34C)[C@@H]1CC[C@@]2(O)Cc1ccccn1 |
| InChI | InChI=1S/C25H35NO2/c1-22-11-4-5-12-24(22,27)14-8-19-20(22)9-13-23(2)21(19)10-15-25(23,28)17-18-7-3-6-16-26-18/h3,5-7,12,16,19-21,27-28H,4,8-11,13-15,17H2,1-2H3/t19-,20+,21+,22-,23+,24+,25-/m1/s1 |
| InChIKey | CSTBSFFMFPCNLW-YYVBKRFLSA-N |
| XLogP | 4.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|