C35H35ClN2O3 — CID 72696782
(3E)-3-[(4-chlorophenyl)methylidene]-7-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexoxy]chromen-4-one (PubChem CID 72696782) has the molecular formula C35H35ClN2O3 and a molecular weight of 567.13 g/mol. Its IUPAC name is (3E)-3-[(4-chlorophenyl)methylidene]-7-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexoxy]chromen-4-one.
| Compound Name | (3E)-3-[(4-chlorophenyl)methylidene]-7-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexoxy]chromen-4-one |
|---|---|
| PubChem CID | 72696782 |
| Molecular Formula | C35H35ClN2O3 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (3E)-3-[(4-chlorophenyl)methylidene]-7-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexoxy]chromen-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)COc2cc(OCCCCCCNc3c4c(nc5ccccc35)CCCC4)ccc21 |
| InChI | InChI=1S/C35H35ClN2O3/c36-26-15-13-24(14-16-26)21-25-23-41-33-22-27(17-18-30(33)35(25)39)40-20-8-2-1-7-19-37-34-28-9-3-5-11-31(28)38-32-12-6-4-10-29(32)34/h3,5,9,11,13-18,21-22H,1-2,4,6-8,10,12,19-20,23H2,(H,37,38)/b25-21+ |
| InChIKey | JQKODBXTRUQWIX-NJNXFGOHSA-N |
| XLogP | 8.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|