C31H36O7 — CID 72696900
1,2,3-trimethoxy-5-[(Z)-2-[4-methoxy-3-[(E)-5-[2-(methoxymethoxy)phenyl]pent-4-enoxy]phenyl]ethenyl]benzene (PubChem CID 72696900) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-2-[4-methoxy-3-[(E)-5-[2-(methoxymethoxy)phenyl]pent-4-enoxy]phenyl]ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-2-[4-methoxy-3-[(E)-5-[2-(methoxymethoxy)phenyl]pent-4-enoxy]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 72696900 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-2-[4-methoxy-3-[(E)-5-[2-(methoxymethoxy)phenyl]pent-4-enoxy]phenyl]ethenyl]benzene |
| SMILES | COCOc1ccccc1/C=C/CCCOc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C31H36O7/c1-32-22-38-26-13-9-8-12-25(26)11-7-6-10-18-37-28-19-23(16-17-27(28)33-2)14-15-24-20-29(34-3)31(36-5)30(21-24)35-4/h7-9,11-17,19-21H,6,10,18,22H2,1-5H3/b11-7+,15-14- |
| InChIKey | KEQLLCCBCHWRBZ-XBOVJTPTSA-N |
| XLogP | 6.75 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|