C36H37ClN2O4 — CID 72696920
(3E)-7-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexoxy]-3-[(4-methoxyphenyl)methylidene]chromen-4-one (PubChem CID 72696920) has the molecular formula C36H37ClN2O4 and a molecular weight of 597.16 g/mol. Its IUPAC name is (3E)-7-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexoxy]-3-[(4-methoxyphenyl)methylidene]chromen-4-one.
| Compound Name | (3E)-7-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexoxy]-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
|---|---|
| PubChem CID | 72696920 |
| Molecular Formula | C36H37ClN2O4 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | (3E)-7-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexoxy]-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
| SMILES | COc1ccc(/C=C2\COc3cc(OCCCCCCNc4c5c(nc6cc(Cl)ccc46)CCCC5)ccc3C2=O)cc1 |
| InChI | InChI=1S/C36H37ClN2O4/c1-41-27-13-10-24(11-14-27)20-25-23-43-34-22-28(15-17-31(34)36(25)40)42-19-7-3-2-6-18-38-35-29-8-4-5-9-32(29)39-33-21-26(37)12-16-30(33)35/h10-17,20-22H,2-9,18-19,23H2,1H3,(H,38,39)/b25-20+ |
| InChIKey | HMSFDXCISPMZNG-LKUDQCMESA-N |
| XLogP | 8.49 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|