C19H36O4Si — CID 72697219
methyl 3-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propanoate (PubChem CID 72697219) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is methyl 3-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propanoate.
| Compound Name | methyl 3-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propanoate |
|---|---|
| PubChem CID | 72697219 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | methyl 3-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12O[C@]1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC2(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-16(2,3)24(8,9)22-14-12-17(4,5)19(11-10-15(20)21-7)18(6,13-14)23-19/h14H,10-13H2,1-9H3/t14-,18+,19-/m0/s1 |
| InChIKey | PHRWLBLABWKANK-KYNGSXCRSA-N |
| XLogP | 4.68 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|