C17H32O3Si — CID 72697221
2-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]acetaldehyde (PubChem CID 72697221) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 2-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 72697221 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 2-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]acetaldehyde |
| SMILES | CC1(C)C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C)O[C@@]12CC=O |
| InChI | InChI=1S/C17H32O3Si/c1-14(2,3)21(7,8)19-13-11-15(4,5)17(9-10-18)16(6,12-13)20-17/h10,13H,9,11-12H2,1-8H3/t13-,16+,17-/m0/s1 |
| InChIKey | QHQOPQGNOBLIQV-XKQJLSEDSA-N |
| XLogP | 4.31 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|