C16H18O6S2 — CID 72697238
(1S,2S,4R,6R)-8-methyl-2-(4-methylphenyl)sulfonyl-9-methylsulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene (PubChem CID 72697238) has the molecular formula C16H18O6S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1S,2S,4R,6R)-8-methyl-2-(4-methylphenyl)sulfonyl-9-methylsulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene.
| Compound Name | (1S,2S,4R,6R)-8-methyl-2-(4-methylphenyl)sulfonyl-9-methylsulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene |
|---|---|
| PubChem CID | 72697238 |
| Molecular Formula | C16H18O6S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (1S,2S,4R,6R)-8-methyl-2-(4-methylphenyl)sulfonyl-9-methylsulfonyl-5,7-dioxatricyclo[4.3.0.02,4]non-8-ene |
| SMILES | CC1=C(S(C)(=O)=O)[C@H]2[C@@H](O1)O[C@@H]1C[C@@]12S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H18O6S2/c1-9-4-6-11(7-5-9)24(19,20)16-8-12(16)22-15-13(16)14(10(2)21-15)23(3,17)18/h4-7,12-13,15H,8H2,1-3H3/t12-,13+,15+,16-/m1/s1 |
| InChIKey | YOGAXNBPBMGXSB-BFJAYTPKSA-N |
| XLogP | 1.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |