C25H36O4 — CID 72697366
(2E,4E,6E,8E,10E)-12-hydroxy-13-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal (PubChem CID 72697366) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-12-hydroxy-13-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-12-hydroxy-13-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 72697366 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (2E,4E,6E,8E,10E)-12-hydroxy-13-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal |
| SMILES | C/C(C=O)=C\C=C\C=C(C)\C=C\C=C(/C)C(O)C[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C25H36O4/c1-18(10-7-8-11-19(2)17-26)12-9-13-20(3)22(28)16-25-23(4,5)14-21(27)15-24(25,6)29-25/h7-13,17,21-22,27-28H,14-16H2,1-6H3/b8-7+,12-9+,18-10+,19-11+,20-13+/t21-,22?,24+,25-/m0/s1 |
| InChIKey | GOJPZQSCKXDGFK-HQQWBOTBSA-N |
| XLogP | 4.60 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|