C42H48N4O7 — CID 72697391
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate (PubChem CID 72697391) has the molecular formula C42H48N4O7 and a molecular weight of 720.87 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 72697391 |
| Molecular Formula | C42H48N4O7 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C42H48N4O7/c1-3-31-26-46-23-20-32(31)24-38(46)39(34-19-22-43-36-18-17-33(50-2)25-35(34)36)53-40(47)37(45-42(49)52-28-30-14-8-5-9-15-30)16-10-11-21-44-41(48)51-27-29-12-6-4-7-13-29/h3-9,12-15,17-19,22,25,31-32,37-39H,1,10-11,16,20-21,23-24,26-28H2,2H3,(H,44,48)(H,45,49)/t31-,32-,37-,38-,39+/m0/s1 |
| InChIKey | GVSGGQPFYRRNSB-HDDJNHRASA-N |
| XLogP | 7.12 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|