C19H13Cl2N3O2S — CID 72697463
(10Z)-10-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-11-thia-3,5,8-triazatricyclo[6.3.0.01,5]undec-3-en-9-one (PubChem CID 72697463) has the molecular formula C19H13Cl2N3O2S and a molecular weight of 418.31 g/mol. Its IUPAC name is (10Z)-10-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-11-thia-3,5,8-triazatricyclo[6.3.0.01,5]undec-3-en-9-one.
| Compound Name | (10Z)-10-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-11-thia-3,5,8-triazatricyclo[6.3.0.01,5]undec-3-en-9-one |
|---|---|
| PubChem CID | 72697463 |
| Molecular Formula | C19H13Cl2N3O2S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | (10Z)-10-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-11-thia-3,5,8-triazatricyclo[6.3.0.01,5]undec-3-en-9-one |
| SMILES | O=C1/C(=C/c2ccccc2)SC23ON=C(c4c(Cl)cccc4Cl)N2CCN13 |
| InChI | InChI=1S/C19H13Cl2N3O2S/c20-13-7-4-8-14(21)16(13)17-22-26-19-23(17)9-10-24(19)18(25)15(27-19)11-12-5-2-1-3-6-12/h1-8,11H,9-10H2/b15-11- |
| InChIKey | UPRGVWATZIPLLG-PTNGSMBKSA-N |
| XLogP | 4.23 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|