C17H19N3O — CID 72697557
1-benzyl-2-butyl-5-oxidoimidazo[4,5-c]pyridin-5-ium (PubChem CID 72697557) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-benzyl-2-butyl-5-oxidoimidazo[4,5-c]pyridin-5-ium.
| Compound Name | 1-benzyl-2-butyl-5-oxidoimidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 72697557 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-benzyl-2-butyl-5-oxidoimidazo[4,5-c]pyridin-5-ium |
| SMILES | CCCCc1nc2c[n+]([O-])ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N3O/c1-2-3-9-17-18-15-13-19(21)11-10-16(15)20(17)12-14-7-5-4-6-8-14/h4-8,10-11,13H,2-3,9,12H2,1H3 |
| InChIKey | QJZWMWJJAXKDQD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|