C20H27ClN4O2 — CID 72697560
4-N-benzyl-6-chloro-3-nitro-2-N-(2,4,4-trimethylpentan-2-yl)pyridine-2,4-diamine (PubChem CID 72697560) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 4-N-benzyl-6-chloro-3-nitro-2-N-(2,4,4-trimethylpentan-2-yl)pyridine-2,4-diamine.
| Compound Name | 4-N-benzyl-6-chloro-3-nitro-2-N-(2,4,4-trimethylpentan-2-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 72697560 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-N-benzyl-6-chloro-3-nitro-2-N-(2,4,4-trimethylpentan-2-yl)pyridine-2,4-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc(Cl)cc(NCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27ClN4O2/c1-19(2,3)13-20(4,5)24-18-17(25(26)27)15(11-16(21)23-18)22-12-14-9-7-6-8-10-14/h6-11H,12-13H2,1-5H3,(H2,22,23,24) |
| InChIKey | SSBOYIASTLAMQK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|