C35H35NO2P2+2 — CID 72697781
4-(hydroxymethyl)-2-methyl-6,6,9,9-tetraphenyl-5,7,8,10-tetrahydro-[1,4]diphosphocino[6,7-b]pyridine-6,9-diium-3-ol (PubChem CID 72697781) has the molecular formula C35H35NO2P2+2 and a molecular weight of 563.62 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-methyl-6,6,9,9-tetraphenyl-5,7,8,10-tetrahydro-[1,4]diphosphocino[6,7-b]pyridine-6,9-diium-3-ol.
| Compound Name | 4-(hydroxymethyl)-2-methyl-6,6,9,9-tetraphenyl-5,7,8,10-tetrahydro-[1,4]diphosphocino[6,7-b]pyridine-6,9-diium-3-ol |
|---|---|
| PubChem CID | 72697781 |
| Molecular Formula | C35H35NO2P2+2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 4-(hydroxymethyl)-2-methyl-6,6,9,9-tetraphenyl-5,7,8,10-tetrahydro-[1,4]diphosphocino[6,7-b]pyridine-6,9-diium-3-ol |
| SMILES | Cc1nc2c(c(CO)c1O)C[P+](c1ccccc1)(c1ccccc1)CC[P+](c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C35H34NO2P2/c1-27-35(38)32(24-37)33-25-39(28-14-6-2-7-15-28,29-16-8-3-9-17-29)22-23-40(26-34(33)36-27,30-18-10-4-11-19-30)31-20-12-5-13-21-31/h2-21,37H,22-26H2,1H3/q+1/p+1 |
| InChIKey | QSUMEGUYQQHSEX-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|