C37H44N2O8S — CID 72697878
[1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]piperidin-4-yl]methyl 3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxylate;methanesulfonic acid (PubChem CID 72697878) has the molecular formula C37H44N2O8S and a molecular weight of 676.83 g/mol. Its IUPAC name is [1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]piperidin-4-yl]methyl 3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxylate;methanesulfonic acid.
| Compound Name | [1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]piperidin-4-yl]methyl 3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxylate;methanesulfonic acid |
|---|---|
| PubChem CID | 72697878 |
| Molecular Formula | C37H44N2O8S |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | [1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]piperidin-4-yl]methyl 3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxylate;methanesulfonic acid |
| SMILES | CCCCOC(=O)c1ccccc1-c1ccc(CN2CCC(COC(=O)c3c4n(c5ccccc35)CCCO4)CC2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C36H40N2O5.CH4O3S/c1-2-3-22-42-35(39)30-10-5-4-9-29(30)28-15-13-26(14-16-28)24-37-20-17-27(18-21-37)25-43-36(40)33-31-11-6-7-12-32(31)38-19-8-23-41-34(33)38;1-5(2,3)4/h4-7,9-16,27H,2-3,8,17-25H2,1H3;1H3,(H,2,3,4) |
| InChIKey | XQKXXSZEKLHXHR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|