About 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole
2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole (PubChem CID 72697919) has the molecular formula C22H18Cl2N2O
and a molecular weight of 397.31 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole |
| PubChem CID | 72697919 |
| Molecular Formula | C22H18Cl2N2O |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(c3ccccc3Cl)C(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O/c1-27-18-11-9-15(10-12-18)20-14-22(16-5-4-6-17(23)13-16)26(25-20)21-8-3-2-7-19(21)24/h2-13,22H,14H2,1H3 |
| InChIKey | XYDGAGBGTVVDEO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole?
The IUPAC name of 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole (CID 72697919) is 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole.
What is the SMILES notation for 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole?
The canonical SMILES for 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole is COc1ccc(C2=NN(c3ccccc3Cl)C(c3cccc(Cl)c3)C2)cc1.
What is the InChIKey of 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole?
The InChIKey is XYDGAGBGTVVDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N2O/c1-27-18-11-9-15(10-12-18)20-14-22(16-5-4-6-17(23)13-16)26(25-20)21-8-3-2-7-19(21)24/h2-13,22H,14H2,1H3.
What are the key properties of 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole?
2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole has a molecular weight of 397.31 g/mol, XLogP of 6.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazole is sourced from PubChem (CID 72697919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).