C10H13IO4 — CID 72697969
(3aS,4S,7aR)-4-hydroxy-6-iodo-2,2,3a-trimethyl-4,7a-dihydro-1,3-benzodioxol-5-one (PubChem CID 72697969) has the molecular formula C10H13IO4 and a molecular weight of 324.11 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-hydroxy-6-iodo-2,2,3a-trimethyl-4,7a-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (3aS,4S,7aR)-4-hydroxy-6-iodo-2,2,3a-trimethyl-4,7a-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 72697969 |
| Molecular Formula | C10H13IO4 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (3aS,4S,7aR)-4-hydroxy-6-iodo-2,2,3a-trimethyl-4,7a-dihydro-1,3-benzodioxol-5-one |
| SMILES | CC1(C)O[C@@H]2C=C(I)C(=O)[C@@H](O)[C@]2(C)O1 |
| InChI | InChI=1S/C10H13IO4/c1-9(2)14-6-4-5(11)7(12)8(13)10(6,3)15-9/h4,6,8,13H,1-3H3/t6-,8-,10-/m1/s1 |
| InChIKey | FQPIDMQREBBPPG-GTNGPMTGSA-N |
| XLogP | 1.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|