About 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine
5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine (PubChem CID 72698086) has the molecular formula C20H20F3N3O
and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine.
Molecular Properties
| Compound Name | 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine |
| PubChem CID | 72698086 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine |
| SMILES | Fc1cccc2c1nc(OCC1CCN(CC(F)F)CC1)c1cccnc12 |
| InChI | InChI=1S/C20H20F3N3O/c21-16-5-1-3-14-18-15(4-2-8-24-18)20(25-19(14)16)27-12-13-6-9-26(10-7-13)11-17(22)23/h1-5,8,13,17H,6-7,9-12H2 |
| InChIKey | PFDBGGQICOJWFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine?
The IUPAC name of 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine (CID 72698086) is 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine.
What is the SMILES notation for 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine?
The canonical SMILES for 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine is Fc1cccc2c1nc(OCC1CCN(CC(F)F)CC1)c1cccnc12.
What is the InChIKey of 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine?
The InChIKey is PFDBGGQICOJWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N3O/c21-16-5-1-3-14-18-15(4-2-8-24-18)20(25-19(14)16)27-12-13-6-9-26(10-7-13)11-17(22)23/h1-5,8,13,17H,6-7,9-12H2.
What are the key properties of 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine?
5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine has a molecular weight of 375.39 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(2,2-difluoroethyl)piperidin-4-yl]methoxy]-7-fluorobenzo[h][1,6]naphthyridine is sourced from PubChem (CID 72698086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).