C21H21F4N3O — CID 72698087
7-fluoro-5-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine (PubChem CID 72698087) has the molecular formula C21H21F4N3O and a molecular weight of 407.41 g/mol. Its IUPAC name is 7-fluoro-5-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine.
| Compound Name | 7-fluoro-5-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 72698087 |
| Molecular Formula | C21H21F4N3O |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 7-fluoro-5-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine |
| SMILES | Fc1cccc2c1nc(OCC1CCN(CCC(F)(F)F)CC1)c1cccnc12 |
| InChI | InChI=1S/C21H21F4N3O/c22-17-5-1-3-15-18-16(4-2-9-26-18)20(27-19(15)17)29-13-14-6-10-28(11-7-14)12-8-21(23,24)25/h1-5,9,14H,6-8,10-13H2 |
| InChIKey | RVXJKDQROPYYOF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|