C22H23F4N3O — CID 72698088
7-fluoro-5-[[1-(4,4,4-trifluorobutyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine (PubChem CID 72698088) has the molecular formula C22H23F4N3O and a molecular weight of 421.44 g/mol. Its IUPAC name is 7-fluoro-5-[[1-(4,4,4-trifluorobutyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine.
| Compound Name | 7-fluoro-5-[[1-(4,4,4-trifluorobutyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 72698088 |
| Molecular Formula | C22H23F4N3O |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 7-fluoro-5-[[1-(4,4,4-trifluorobutyl)piperidin-4-yl]methoxy]benzo[h][1,6]naphthyridine |
| SMILES | Fc1cccc2c1nc(OCC1CCN(CCCC(F)(F)F)CC1)c1cccnc12 |
| InChI | InChI=1S/C22H23F4N3O/c23-18-6-1-4-16-19-17(5-2-10-27-19)21(28-20(16)18)30-14-15-7-12-29(13-8-15)11-3-9-22(24,25)26/h1-2,4-6,10,15H,3,7-9,11-14H2 |
| InChIKey | YKBQHBXRXWGQIZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|