C25H33NO3 — CID 72698100
[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,2-dimethyl-8-(3-methylbut-2-enyl)chromene-6-carboxylate (PubChem CID 72698100) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is [(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,2-dimethyl-8-(3-methylbut-2-enyl)chromene-6-carboxylate.
| Compound Name | [(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,2-dimethyl-8-(3-methylbut-2-enyl)chromene-6-carboxylate |
|---|---|
| PubChem CID | 72698100 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | [(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,2-dimethyl-8-(3-methylbut-2-enyl)chromene-6-carboxylate |
| SMILES | CC(C)=CCc1cc(C(=O)OC[C@H]2CCN3CCC[C@@H]23)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C25H33NO3/c1-17(2)7-8-18-14-21(15-19-9-11-25(3,4)29-23(18)19)24(27)28-16-20-10-13-26-12-5-6-22(20)26/h7,9,11,14-15,20,22H,5-6,8,10,12-13,16H2,1-4H3/t20-,22+/m1/s1 |
| InChIKey | QPMVCCHCSFGJML-IRLDBZIGSA-N |
| XLogP | 5.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|