C10H15IO4 — CID 72698113
(3aS,4R,5S,7aR)-6-iodo-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxole-4,5-diol (PubChem CID 72698113) has the molecular formula C10H15IO4 and a molecular weight of 326.13 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-6-iodo-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxole-4,5-diol.
| Compound Name | (3aS,4R,5S,7aR)-6-iodo-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxole-4,5-diol |
|---|---|
| PubChem CID | 72698113 |
| Molecular Formula | C10H15IO4 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (3aS,4R,5S,7aR)-6-iodo-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxole-4,5-diol |
| SMILES | CC1(C)O[C@@H]2C=C(I)[C@@H](O)[C@@H](O)[C@]2(C)O1 |
| InChI | InChI=1S/C10H15IO4/c1-9(2)14-6-4-5(11)7(12)8(13)10(6,3)15-9/h4,6-8,12-13H,1-3H3/t6-,7-,8-,10-/m1/s1 |
| InChIKey | BOQCVLOWHOANBI-FDDDBJFASA-N |
| XLogP | 0.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|