C23H31N5O5 — CID 72698225
1,3-diethyl-9-[2-(3,4,5-trimethoxyphenyl)ethyl]-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 72698225) has the molecular formula C23H31N5O5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1,3-diethyl-9-[2-(3,4,5-trimethoxyphenyl)ethyl]-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 1,3-diethyl-9-[2-(3,4,5-trimethoxyphenyl)ethyl]-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72698225 |
| Molecular Formula | C23H31N5O5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1,3-diethyl-9-[2-(3,4,5-trimethoxyphenyl)ethyl]-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c2c(nc3n2CCCN3CCc2cc(OC)c(OC)c(OC)c2)n(CC)c1=O |
| InChI | InChI=1S/C23H31N5O5/c1-6-26-20-18(21(29)27(7-2)23(26)30)28-11-8-10-25(22(28)24-20)12-9-15-13-16(31-3)19(33-5)17(14-15)32-4/h13-14H,6-12H2,1-5H3 |
| InChIKey | MTVWPIKSKRYWRM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |