C19H19NO2 — CID 726983
(2R)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-ol (PubChem CID 726983) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2R)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-ol.
| Compound Name | (2R)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-ol |
|---|---|
| PubChem CID | 726983 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2R)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-ol |
| SMILES | CN1c2ccccc2C(C)(C)[C@]12C=Cc1cc(O)ccc1O2 |
| InChI | InChI=1S/C19H19NO2/c1-18(2)15-6-4-5-7-16(15)20(3)19(18)11-10-13-12-14(21)8-9-17(13)22-19/h4-12,21H,1-3H3/t19-/m1/s1 |
| InChIKey | UHRBDHPBCHWWAG-LJQANCHMSA-N |
| XLogP | 3.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |