About ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate
ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate (PubChem CID 72698361) has the molecular formula C15H17F2NO2
and a molecular weight of 281.30 g/mol. Its IUPAC name is ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate |
| PubChem CID | 72698361 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(F)(F)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H17F2NO2/c1-2-20-14(19)13-8-15(16,17)11-18(10-13)9-12-6-4-3-5-7-12/h3-8H,2,9-11H2,1H3 |
| InChIKey | VTZOCJWETIAZFF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate?
The IUPAC name of ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate (CID 72698361) is ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate?
The canonical SMILES for ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate is CCOC(=O)C1=CC(F)(F)CN(Cc2ccccc2)C1.
What is the InChIKey of ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate?
The InChIKey is VTZOCJWETIAZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO2/c1-2-20-14(19)13-8-15(16,17)11-18(10-13)9-12-6-4-3-5-7-12/h3-8H,2,9-11H2,1H3.
What are the key properties of ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate?
ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate has a molecular weight of 281.30 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-5,5-difluoro-2,6-dihydropyridine-3-carboxylate is sourced from PubChem (CID 72698361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).